C10H22F4NO4P — CID 118073235
bis(2,2-difluoroethyl) hydrogen phosphate;N-propan-2-ylpropan-2-amine (PubChem CID 118073235) has the molecular formula C10H22F4NO4P and a molecular weight of 327.26 g/mol. Its IUPAC name is bis(2,2-difluoroethyl) hydrogen phosphate;N-propan-2-ylpropan-2-amine.
| Compound Name | bis(2,2-difluoroethyl) hydrogen phosphate;N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 118073235 |
| Molecular Formula | C10H22F4NO4P |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | bis(2,2-difluoroethyl) hydrogen phosphate;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.O=P(O)(OCC(F)F)OCC(F)F |
| InChI | InChI=1S/C6H15N.C4H7F4O4P/c1-5(2)7-6(3)4;5-3(6)1-11-13(9,10)12-2-4(7)8/h5-7H,1-4H3;3-4H,1-2H2,(H,9,10) |
| InChIKey | KBQSCZGRAPICNS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|