C2H4F5NO3P2 — CID 164935703
2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane (PubChem CID 164935703) has the molecular formula C2H4F5NO3P2 and a molecular weight of 247.00 g/mol. Its IUPAC name is 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane.
| Compound Name | 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane |
|---|---|
| PubChem CID | 164935703 |
| Molecular Formula | C2H4F5NO3P2 |
| Molecular Weight | 247.00 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane |
| SMILES | O=P(F)(F)NP(=O)(F)OCC(F)F |
| InChI | InChI=1S/C2H4F5NO3P2/c3-2(4)1-11-13(7,10)8-12(5,6)9/h2H,1H2,(H,8,9,10) |
| InChIKey | DYSGDPFYGFXFDR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|