About 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane
2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane (PubChem CID 164935703) has the molecular formula C2H4F5NO3P2
and a molecular weight of 247.00 g/mol. Its IUPAC name is 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane.
Molecular Properties
| Compound Name | 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane |
| PubChem CID | 164935703 |
| Molecular Formula | C2H4F5NO3P2 |
| Molecular Weight | 247.00 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane |
| SMILES | O=P(F)(F)NP(=O)(F)OCC(F)F |
| InChI | InChI=1S/C2H4F5NO3P2/c3-2(4)1-11-13(7,10)8-12(5,6)9/h2H,1H2,(H,8,9,10) |
| InChIKey | DYSGDPFYGFXFDR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane?
The IUPAC name of 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane (CID 164935703) is 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane.
What is the SMILES notation for 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane?
The canonical SMILES for 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane is O=P(F)(F)NP(=O)(F)OCC(F)F.
What is the InChIKey of 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane?
The InChIKey is DYSGDPFYGFXFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4F5NO3P2/c3-2(4)1-11-13(7,10)8-12(5,6)9/h2H,1H2,(H,8,9,10).
What are the key properties of 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane?
2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane has a molecular weight of 247.00 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(difluorophosphorylamino)-fluorophosphoryl]oxy-1,1-difluoroethane is sourced from PubChem (CID 164935703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).