C19H24N2O5S — CID 169451307
1-tert-butyl-5-(4-tert-butylbenzoyl)-6-oxopyridazine-4-sulfonic acid (PubChem CID 169451307) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-tert-butyl-5-(4-tert-butylbenzoyl)-6-oxopyridazine-4-sulfonic acid.
| Compound Name | 1-tert-butyl-5-(4-tert-butylbenzoyl)-6-oxopyridazine-4-sulfonic acid |
|---|---|
| PubChem CID | 169451307 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-tert-butyl-5-(4-tert-butylbenzoyl)-6-oxopyridazine-4-sulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)c2c(S(=O)(=O)O)cnn(C(C)(C)C)c2=O)cc1 |
| InChI | InChI=1S/C19H24N2O5S/c1-18(2,3)13-9-7-12(8-10-13)16(22)15-14(27(24,25)26)11-20-21(17(15)23)19(4,5)6/h7-11H,1-6H3,(H,24,25,26) |
| InChIKey | IPLRICHGOQJIJV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|