C15H15NO3 — CID 142659147
3-amino-4-(4-tert-butylbenzoyl)cyclobut-3-ene-1,2-dione (PubChem CID 142659147) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-amino-4-(4-tert-butylbenzoyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(4-tert-butylbenzoyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659147 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-amino-4-(4-tert-butylbenzoyl)cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)c2c(N)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C15H15NO3/c1-15(2,3)9-6-4-8(5-7-9)12(17)10-11(16)14(19)13(10)18/h4-7H,16H2,1-3H3 |
| InChIKey | PGPNQUAVQHZWBX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|