C18H33NO4 — CID 169451722
2-[3-[[ethyl(propyl)amino]methyl]-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-2-methylpropane-1,3-diol (PubChem CID 169451722) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-[3-[[ethyl(propyl)amino]methyl]-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-2-methylpropane-1,3-diol.
| Compound Name | 2-[3-[[ethyl(propyl)amino]methyl]-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 169451722 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 2-[3-[[ethyl(propyl)amino]methyl]-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-2-methylpropane-1,3-diol |
| SMILES | CCCN(CC)CC1COC2(C=CC(C(C)(CO)CO)CC2)O1 |
| InChI | InChI=1S/C18H33NO4/c1-4-10-19(5-2)11-16-12-22-18(23-16)8-6-15(7-9-18)17(3,13-20)14-21/h6,8,15-16,20-21H,4-5,7,9-14H2,1-3H3 |
| InChIKey | MRYNQRKIJDPPIL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|