C18H33NO4 — CID 169451826
(Z)-1-[(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)methyl-propylamino]ethene-1,2-diol (PubChem CID 169451826) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is (Z)-1-[(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)methyl-propylamino]ethene-1,2-diol.
| Compound Name | (Z)-1-[(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)methyl-propylamino]ethene-1,2-diol |
|---|---|
| PubChem CID | 169451826 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | (Z)-1-[(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)methyl-propylamino]ethene-1,2-diol |
| SMILES | CCCN(CC1COC2(CCC(C(C)(C)C)CC2)O1)/C(O)=C/O |
| InChI | InChI=1S/C18H33NO4/c1-5-10-19(16(21)12-20)11-15-13-22-18(23-15)8-6-14(7-9-18)17(2,3)4/h12,14-15,20-21H,5-11,13H2,1-4H3/b16-12- |
| InChIKey | DISMRTGLVUUREE-VBKFSLOCSA-N |
| XLogP | 3.96 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|