C20H37NO3 — CID 14990428
4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]morpholine (PubChem CID 14990428) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is 4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]morpholine.
| Compound Name | 4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]morpholine |
|---|---|
| PubChem CID | 14990428 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]morpholine |
| SMILES | CC(C)(C)C1CCC2(CC1)OCC(CCCCN1CCOCC1)O2 |
| InChI | InChI=1S/C20H37NO3/c1-19(2,3)17-7-9-20(10-8-17)23-16-18(24-20)6-4-5-11-21-12-14-22-15-13-21/h17-18H,4-16H2,1-3H3 |
| InChIKey | ZVQAJLBOGVKZQT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|