C22H41NO3 — CID 14990429
4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]-2,6-dimethylmorpholine (PubChem CID 14990429) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is 4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 14990429 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | 4-[4-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)butyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(CCCCC2COC3(CCC(C(C)(C)C)CC3)O2)CC(C)O1 |
| InChI | InChI=1S/C22H41NO3/c1-17-14-23(15-18(2)25-17)13-7-6-8-20-16-24-22(26-20)11-9-19(10-12-22)21(3,4)5/h17-20H,6-16H2,1-5H3 |
| InChIKey | ZDPNMPSQPSDAMJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|