C9H8F2OS — CID 169455083
2,3-difluoro-5-(3-sulfanylprop-1-enyl)phenol (PubChem CID 169455083) has the molecular formula C9H8F2OS and a molecular weight of 202.22 g/mol. Its IUPAC name is 2,3-difluoro-5-(3-sulfanylprop-1-enyl)phenol.
| Compound Name | 2,3-difluoro-5-(3-sulfanylprop-1-enyl)phenol |
|---|---|
| PubChem CID | 169455083 |
| Molecular Formula | C9H8F2OS |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2,3-difluoro-5-(3-sulfanylprop-1-enyl)phenol |
| SMILES | Oc1cc(C=CCS)cc(F)c1F |
| InChI | InChI=1S/C9H8F2OS/c10-7-4-6(2-1-3-13)5-8(12)9(7)11/h1-2,4-5,12-13H,3H2 |
| InChIKey | CKLLVAOBJOOYBV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|