C11H11ClO — CID 169458935
3-(4-chloro-3,5-dimethylphenyl)prop-2-enal (PubChem CID 169458935) has the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylphenyl)prop-2-enal.
| Compound Name | 3-(4-chloro-3,5-dimethylphenyl)prop-2-enal |
|---|---|
| PubChem CID | 169458935 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylphenyl)prop-2-enal |
| SMILES | Cc1cc(C=CC=O)cc(C)c1Cl |
| InChI | InChI=1S/C11H11ClO/c1-8-6-10(4-3-5-13)7-9(2)11(8)12/h3-7H,1-2H3 |
| InChIKey | BYMVQRTYRNCOMP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|