C9H7Br2N3O — CID 169462874
4-(3-azidoprop-1-enyl)-2,6-dibromophenol (PubChem CID 169462874) has the molecular formula C9H7Br2N3O and a molecular weight of 332.98 g/mol. Its IUPAC name is 4-(3-azidoprop-1-enyl)-2,6-dibromophenol.
| Compound Name | 4-(3-azidoprop-1-enyl)-2,6-dibromophenol |
|---|---|
| PubChem CID | 169462874 |
| Molecular Formula | C9H7Br2N3O |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | 4-(3-azidoprop-1-enyl)-2,6-dibromophenol |
| SMILES | [N-]=[N+]=NCC=Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C9H7Br2N3O/c10-7-4-6(2-1-3-13-14-12)5-8(11)9(7)15/h1-2,4-5,15H,3H2 |
| InChIKey | JCAGZBNWZMZHJO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|