C13H16N2O5S — CID 169466428
2-[[4-(3-acetamidoprop-1-enyl)phenyl]sulfonylamino]acetic acid (PubChem CID 169466428) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[[4-(3-acetamidoprop-1-enyl)phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-(3-acetamidoprop-1-enyl)phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 169466428 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[[4-(3-acetamidoprop-1-enyl)phenyl]sulfonylamino]acetic acid |
| SMILES | CC(=O)NCC=Cc1ccc(S(=O)(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O5S/c1-10(16)14-8-2-3-11-4-6-12(7-5-11)21(19,20)15-9-13(17)18/h2-7,15H,8-9H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | SWRXUGLIERMKLH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |