C12H14N4O4S — CID 170486237
2-[[4-(4-azidobut-1-enyl)phenyl]sulfonylamino]acetic acid (PubChem CID 170486237) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[[4-(4-azidobut-1-enyl)phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-(4-azidobut-1-enyl)phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 170486237 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[[4-(4-azidobut-1-enyl)phenyl]sulfonylamino]acetic acid |
| SMILES | [N-]=[N+]=NCCC=Cc1ccc(S(=O)(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C12H14N4O4S/c13-16-14-8-2-1-3-10-4-6-11(7-5-10)21(19,20)15-9-12(17)18/h1,3-7,15H,2,8-9H2,(H,17,18) |
| InChIKey | ZBHQKDOKFMUETI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 132.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|