C12H18N4O2 — CID 169467001
tert-butyl N-[3-(5-aminopyrazin-2-yl)prop-2-enyl]carbamate (PubChem CID 169467001) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is tert-butyl N-[3-(5-aminopyrazin-2-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-aminopyrazin-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467001 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | tert-butyl N-[3-(5-aminopyrazin-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1cnc(N)cn1 |
| InChI | InChI=1S/C12H18N4O2/c1-12(2,3)18-11(17)14-6-4-5-9-7-16-10(13)8-15-9/h4-5,7-8H,6H2,1-3H3,(H2,13,16)(H,14,17) |
| InChIKey | PQYCBWXVMILYFB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |