C15H20N2O3 — CID 169467597
tert-butyl N-[3-(6-acetyl-2-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169467597) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is tert-butyl N-[3-(6-acetyl-2-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-acetyl-2-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467597 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | tert-butyl N-[3-(6-acetyl-2-pyridinyl)prop-2-enyl]carbamate |
| SMILES | CC(=O)c1cccc(C=CCNC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H20N2O3/c1-11(18)13-9-5-7-12(17-13)8-6-10-16-14(19)20-15(2,3)4/h5-9H,10H2,1-4H3,(H,16,19) |
| InChIKey | HRRCQYKAOWZVMQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |