C23H18Cl2N2O2 — CID 169469280
9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169469280) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469280 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(2,5-dichloro-3-pyridinyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cc(Cl)cnc1Cl)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H18Cl2N2O2/c24-16-12-15(22(25)27-13-16)6-5-11-26-23(28)29-14-21-19-9-3-1-7-17(19)18-8-2-4-10-20(18)21/h1-10,12-13,21H,11,14H2,(H,26,28) |
| InChIKey | DDBXKPKBHRUCJP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|