C22H19ClN4O2 — CID 169469327
9H-fluoren-9-ylmethyl N-[3-(3-amino-6-chloropyridazin-4-yl)prop-2-enyl]carbamate (PubChem CID 169469327) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3-amino-6-chloropyridazin-4-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3-amino-6-chloropyridazin-4-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469327 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3-amino-6-chloropyridazin-4-yl)prop-2-enyl]carbamate |
| SMILES | Nc1nnc(Cl)cc1C=CCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H19ClN4O2/c23-20-12-14(21(24)27-26-20)6-5-11-25-22(28)29-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-10,12,19H,11,13H2,(H2,24,27)(H,25,28) |
| InChIKey | ROXOQSLMBIZGRD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |