C24H19ClN2O4 — CID 169469960
2-chloro-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]pyridine-4-carboxylic acid (PubChem CID 169469960) has the molecular formula C24H19ClN2O4 and a molecular weight of 434.88 g/mol. Its IUPAC name is 2-chloro-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 169469960 |
| Molecular Formula | C24H19ClN2O4 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-chloro-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]pyridine-4-carboxylic acid |
| SMILES | O=C(NCC=Cc1cnc(Cl)cc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H19ClN2O4/c25-22-12-20(23(28)29)15(13-27-22)6-5-11-26-24(30)31-14-21-18-9-3-1-7-16(18)17-8-2-4-10-19(17)21/h1-10,12-13,21H,11,14H2,(H,26,30)(H,28,29) |
| InChIKey | RJJPZKSWKCYJSJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|