C22H19N3O4 — CID 169469212
4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 169469212) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 169469212 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-[3-(9H-fluoren-9-ylmethoxycarbonylamino)prop-1-enyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(NCC=Cc1cn[nH]c1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H19N3O4/c26-21(27)20-14(12-24-25-20)6-5-11-23-22(28)29-13-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-10,12,19H,11,13H2,(H,23,28)(H,24,25)(H,26,27) |
| InChIKey | KHVFCZOHQYQMDO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |