C25H22N2O3 — CID 169469640
9H-fluoren-9-ylmethyl N-[3-[3-(hydroxyiminomethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 169469640) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[3-(hydroxyiminomethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[3-(hydroxyiminomethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169469640 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[3-(hydroxyiminomethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cccc(C=NO)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22N2O3/c28-25(26-14-6-9-18-7-5-8-19(15-18)16-27-29)30-17-24-22-12-3-1-10-20(22)21-11-2-4-13-23(21)24/h1-13,15-16,24,29H,14,17H2,(H,26,28) |
| InChIKey | LWDKZQMHKGJGBN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|