C27H23N3O2 — CID 169470793
9H-fluoren-9-ylmethyl N-[3-(4-imidazol-1-ylphenyl)prop-2-enyl]carbamate (PubChem CID 169470793) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(4-imidazol-1-ylphenyl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(4-imidazol-1-ylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470793 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(4-imidazol-1-ylphenyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(-n2ccnc2)cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H23N3O2/c31-27(29-15-5-6-20-11-13-21(14-12-20)30-17-16-28-19-30)32-18-26-24-9-3-1-7-22(24)23-8-2-4-10-25(23)26/h1-14,16-17,19,26H,15,18H2,(H,29,31) |
| InChIKey | SUXQEMKTOQLMPV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |