C24H31NO3 — CID 169472791
benzyl N-[3-(4-heptoxyphenyl)prop-2-enyl]carbamate (PubChem CID 169472791) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is benzyl N-[3-(4-heptoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-heptoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472791 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | benzyl N-[3-(4-heptoxyphenyl)prop-2-enyl]carbamate |
| SMILES | CCCCCCCOc1ccc(C=CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-2-3-4-5-9-19-27-23-16-14-21(15-17-23)13-10-18-25-24(26)28-20-22-11-7-6-8-12-22/h6-8,10-17H,2-5,9,18-20H2,1H3,(H,25,26) |
| InChIKey | FCELMKGEBKBCCU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|