C21H25NO2 — CID 169471837
benzyl N-[3-(4-butylphenyl)prop-2-enyl]carbamate (PubChem CID 169471837) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is benzyl N-[3-(4-butylphenyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(4-butylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471837 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | benzyl N-[3-(4-butylphenyl)prop-2-enyl]carbamate |
| SMILES | CCCCc1ccc(C=CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-2-3-8-18-12-14-19(15-13-18)11-7-16-22-21(23)24-17-20-9-5-4-6-10-20/h4-7,9-15H,2-3,8,16-17H2,1H3,(H,22,23) |
| InChIKey | GCLWOJDXNQGSDL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |