C18H19N3O2S — CID 169471954
benzyl N-[3-[4-(carbamothioylamino)phenyl]prop-2-enyl]carbamate (PubChem CID 169471954) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is benzyl N-[3-[4-(carbamothioylamino)phenyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[4-(carbamothioylamino)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169471954 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | benzyl N-[3-[4-(carbamothioylamino)phenyl]prop-2-enyl]carbamate |
| SMILES | NC(=S)Nc1ccc(C=CCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c19-17(24)21-16-10-8-14(9-11-16)7-4-12-20-18(22)23-13-15-5-2-1-3-6-15/h1-11H,12-13H2,(H,20,22)(H3,19,21,24) |
| InChIKey | XKGFWEWGLNYZFB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|