C20H21ClN2O3 — CID 170494713
benzyl N-[4-[4-[(2-chloroacetyl)amino]phenyl]but-3-enyl]carbamate (PubChem CID 170494713) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is benzyl N-[4-[4-[(2-chloroacetyl)amino]phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[4-[(2-chloroacetyl)amino]phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494713 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | benzyl N-[4-[4-[(2-chloroacetyl)amino]phenyl]but-3-enyl]carbamate |
| SMILES | O=C(CCl)Nc1ccc(C=CCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21ClN2O3/c21-14-19(24)23-18-11-9-16(10-12-18)6-4-5-13-22-20(25)26-15-17-7-2-1-3-8-17/h1-4,6-12H,5,13-15H2,(H,22,25)(H,23,24) |
| InChIKey | ZSAUPSQOGUNYEG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|