C20H19N3O2 — CID 169472339
benzyl N-[3-[4-(1H-pyrazol-5-yl)phenyl]prop-2-enyl]carbamate (PubChem CID 169472339) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is benzyl N-[3-[4-(1H-pyrazol-5-yl)phenyl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[4-(1H-pyrazol-5-yl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472339 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | benzyl N-[3-[4-(1H-pyrazol-5-yl)phenyl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1ccc(-c2ccn[nH]2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H19N3O2/c24-20(25-15-17-5-2-1-3-6-17)21-13-4-7-16-8-10-18(11-9-16)19-12-14-22-23-19/h1-12,14H,13,15H2,(H,21,24)(H,22,23) |
| InChIKey | YWWSLMHWUXERAV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |