C16H14FIN2O2 — CID 169472949
benzyl N-[3-(2-fluoro-4-iodo-3-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169472949) has the molecular formula C16H14FIN2O2 and a molecular weight of 412.20 g/mol. Its IUPAC name is benzyl N-[3-(2-fluoro-4-iodo-3-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(2-fluoro-4-iodo-3-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472949 |
| Molecular Formula | C16H14FIN2O2 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | benzyl N-[3-(2-fluoro-4-iodo-3-pyridinyl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1c(I)ccnc1F)OCc1ccccc1 |
| InChI | InChI=1S/C16H14FIN2O2/c17-15-13(14(18)8-10-19-15)7-4-9-20-16(21)22-11-12-5-2-1-3-6-12/h1-8,10H,9,11H2,(H,20,21) |
| InChIKey | SAFFYTCHKPHMOB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|