C20H18ClN3O2 — CID 169472960
benzyl N-[3-[1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enyl]carbamate (PubChem CID 169472960) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is benzyl N-[3-[1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169472960 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | benzyl N-[3-[1-(3-chlorophenyl)pyrazol-4-yl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cnn(-c2cccc(Cl)c2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H18ClN3O2/c21-18-9-4-10-19(12-18)24-14-17(13-23-24)8-5-11-22-20(25)26-15-16-6-2-1-3-7-16/h1-10,12-14H,11,15H2,(H,22,25) |
| InChIKey | OUICOBDDYOESRD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |