C28H25N3O2 — CID 169470910
9H-fluoren-9-ylmethyl N-[3-[1-(3-methylphenyl)pyrazol-4-yl]prop-2-enyl]carbamate (PubChem CID 169470910) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[1-(3-methylphenyl)pyrazol-4-yl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[1-(3-methylphenyl)pyrazol-4-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470910 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[1-(3-methylphenyl)pyrazol-4-yl]prop-2-enyl]carbamate |
| SMILES | Cc1cccc(-n2cc(C=CCNC(=O)OCC3c4ccccc4-c4ccccc43)cn2)c1 |
| InChI | InChI=1S/C28H25N3O2/c1-20-8-6-10-22(16-20)31-18-21(17-30-31)9-7-15-29-28(32)33-19-27-25-13-4-2-11-23(25)24-12-3-5-14-26(24)27/h2-14,16-18,27H,15,19H2,1H3,(H,29,32) |
| InChIKey | QSBNLBIRUAWVCU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |