C27H22N4O4 — CID 169470552
9H-fluoren-9-ylmethyl N-[3-[1-(2-nitrophenyl)pyrazol-4-yl]prop-2-enyl]carbamate (PubChem CID 169470552) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[1-(2-nitrophenyl)pyrazol-4-yl]prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[1-(2-nitrophenyl)pyrazol-4-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470552 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[1-(2-nitrophenyl)pyrazol-4-yl]prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1cnn(-c2ccccc2[N+](=O)[O-])c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H22N4O4/c32-27(35-18-24-22-11-3-1-9-20(22)21-10-2-4-12-23(21)24)28-15-7-8-19-16-29-30(17-19)25-13-5-6-14-26(25)31(33)34/h1-14,16-17,24H,15,18H2,(H,28,32) |
| InChIKey | TVSFRSGKKJDBSX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|