C25H20N4O4 — CID 169470373
9H-fluoren-9-ylmethyl N-[3-(7-nitro-2H-indazol-3-yl)prop-2-enyl]carbamate (PubChem CID 169470373) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(7-nitro-2H-indazol-3-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(7-nitro-2H-indazol-3-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169470373 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(7-nitro-2H-indazol-3-yl)prop-2-enyl]carbamate |
| SMILES | O=C(NCC=Cc1[nH]nc2c([N+](=O)[O-])cccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H20N4O4/c30-25(26-14-6-12-22-20-11-5-13-23(29(31)32)24(20)28-27-22)33-15-21-18-9-3-1-7-16(18)17-8-2-4-10-19(17)21/h1-13,21H,14-15H2,(H,26,30)(H,27,28) |
| InChIKey | MLLUPGNETLVXBM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|