C28H24N4O4 — CID 170493248
9H-fluoren-9-ylmethyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-enyl]carbamate (PubChem CID 170493248) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170493248 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[1-(2-nitrophenyl)pyrazol-4-yl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cnn(-c2ccccc2[N+](=O)[O-])c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H24N4O4/c33-28(36-19-25-23-12-3-1-10-21(23)22-11-2-4-13-24(22)25)29-16-8-7-9-20-17-30-31(18-20)26-14-5-6-15-27(26)32(34)35/h1-7,9-15,17-18,25H,8,16,19H2,(H,29,33) |
| InChIKey | DMAPLGFIJDOMRZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|