C23H22N4O4 — CID 170492365
9H-fluoren-9-ylmethyl N-[4-(2-methyl-5-nitro-1H-imidazol-4-yl)but-3-enyl]carbamate (PubChem CID 170492365) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-methyl-5-nitro-1H-imidazol-4-yl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-methyl-5-nitro-1H-imidazol-4-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492365 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-methyl-5-nitro-1H-imidazol-4-yl)but-3-enyl]carbamate |
| SMILES | Cc1nc(C=CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C23H22N4O4/c1-15-25-21(22(26-15)27(29)30)12-6-7-13-24-23(28)31-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-6,8-12,20H,7,13-14H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | UYRYYYMFTJCTIU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|