C27H25N3O2 — CID 170492429
9H-fluoren-9-ylmethyl N-[4-(2-methyl-3H-benzimidazol-5-yl)but-3-enyl]carbamate (PubChem CID 170492429) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-methyl-3H-benzimidazol-5-yl)but-3-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-methyl-3H-benzimidazol-5-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170492429 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-methyl-3H-benzimidazol-5-yl)but-3-enyl]carbamate |
| SMILES | Cc1nc2ccc(C=CCCNC(=O)OCC3c4ccccc4-c4ccccc43)cc2[nH]1 |
| InChI | InChI=1S/C27H25N3O2/c1-18-29-25-14-13-19(16-26(25)30-18)8-6-7-15-28-27(31)32-17-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24/h2-6,8-14,16,24H,7,15,17H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | DUEAMCQHLYVCNF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|