C30H28N2O4 — CID 170493243
ethyl 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-1H-indole-2-carboxylate (PubChem CID 170493243) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is ethyl 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 170493243 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ethyl 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(C=CCCNC(=O)OCC3c4ccccc4-c4ccccc43)cc2[nH]1 |
| InChI | InChI=1S/C30H28N2O4/c1-2-35-29(33)28-18-21-15-14-20(17-27(21)32-28)9-7-8-16-31-30(34)36-19-26-24-12-5-3-10-22(24)23-11-4-6-13-25(23)26/h3-7,9-15,17-18,26,32H,2,8,16,19H2,1H3,(H,31,34) |
| InChIKey | GCRCBESJGOBVQG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|