C8H6BrCl2N — CID 169475227
2-(3-bromoprop-1-enyl)-3,5-dichloropyridine (PubChem CID 169475227) has the molecular formula C8H6BrCl2N and a molecular weight of 266.95 g/mol. Its IUPAC name is 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine.
| Compound Name | 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine |
|---|---|
| PubChem CID | 169475227 |
| Molecular Formula | C8H6BrCl2N |
| Molecular Weight | 266.95 g/mol |
| Exact Mass | 264.91 |
| IUPAC Name | 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine |
| SMILES | Clc1cnc(C=CCBr)c(Cl)c1 |
| InChI | InChI=1S/C8H6BrCl2N/c9-3-1-2-8-7(11)4-6(10)5-12-8/h1-2,4-5H,3H2 |
| InChIKey | GQSNRYXUIXQOCK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|