About 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine
2-(3-bromoprop-1-enyl)-3,5-dichloropyridine (PubChem CID 169475227) has the molecular formula C8H6BrCl2N
and a molecular weight of 266.95 g/mol. Its IUPAC name is 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine.
Molecular Properties
| Compound Name | 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine |
| PubChem CID | 169475227 |
| Molecular Formula | C8H6BrCl2N |
| Molecular Weight | 266.95 g/mol |
| Exact Mass | 264.91 |
| IUPAC Name | 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine |
| SMILES | Clc1cnc(C=CCBr)c(Cl)c1 |
| InChI | InChI=1S/C8H6BrCl2N/c9-3-1-2-8-7(11)4-6(10)5-12-8/h1-2,4-5H,3H2 |
| InChIKey | GQSNRYXUIXQOCK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine?
The IUPAC name of 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine (CID 169475227) is 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine.
What is the SMILES notation for 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine?
The canonical SMILES for 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine is Clc1cnc(C=CCBr)c(Cl)c1.
What is the InChIKey of 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine?
The InChIKey is GQSNRYXUIXQOCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrCl2N/c9-3-1-2-8-7(11)4-6(10)5-12-8/h1-2,4-5H,3H2.
What are the key properties of 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine?
2-(3-bromoprop-1-enyl)-3,5-dichloropyridine has a molecular weight of 266.95 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromoprop-1-enyl)-3,5-dichloropyridine is sourced from PubChem (CID 169475227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).