C11H8ClF3O — CID 169478110
1-[4-(3-chloroprop-1-enyl)phenyl]-2,2,2-trifluoroethanone (PubChem CID 169478110) has the molecular formula C11H8ClF3O and a molecular weight of 248.63 g/mol. Its IUPAC name is 1-[4-(3-chloroprop-1-enyl)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-(3-chloroprop-1-enyl)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 169478110 |
| Molecular Formula | C11H8ClF3O |
| Molecular Weight | 248.63 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1-[4-(3-chloroprop-1-enyl)phenyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(C=CCCl)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3O/c12-7-1-2-8-3-5-9(6-4-8)10(16)11(13,14)15/h1-6H,7H2 |
| InChIKey | YYWPYTWJMSXREX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|