C12H10F3N3O — CID 170486101
1-[4-(4-azidobut-1-enyl)phenyl]-2,2,2-trifluoroethanone (PubChem CID 170486101) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is 1-[4-(4-azidobut-1-enyl)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-(4-azidobut-1-enyl)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 170486101 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-[4-(4-azidobut-1-enyl)phenyl]-2,2,2-trifluoroethanone |
| SMILES | [N-]=[N+]=NCCC=Cc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3N3O/c13-12(14,15)11(19)10-6-4-9(5-7-10)3-1-2-8-17-18-16/h1,3-7H,2,8H2 |
| InChIKey | ZTZFUMDGIJBLQX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|