C23H15F4N3O5S — CID 169487959
6-ethynyl-N-[4-fluoro-2-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]phenyl]-4-methoxypyridine-3-carboxamide (PubChem CID 169487959) has the molecular formula C23H15F4N3O5S and a molecular weight of 521.45 g/mol. Its IUPAC name is 6-ethynyl-N-[4-fluoro-2-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]phenyl]-4-methoxypyridine-3-carboxamide.
| Compound Name | 6-ethynyl-N-[4-fluoro-2-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]phenyl]-4-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 169487959 |
| Molecular Formula | C23H15F4N3O5S |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 6-ethynyl-N-[4-fluoro-2-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]phenyl]-4-methoxypyridine-3-carboxamide |
| SMILES | C#Cc1cc(OC)c(C(=O)Nc2ccc(F)cc2C(=O)Nc2cccc(S(=O)(=O)C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C23H15F4N3O5S/c1-3-14-11-20(35-2)18(12-28-14)22(32)30-19-8-7-13(24)9-17(19)21(31)29-15-5-4-6-16(10-15)36(33,34)23(25,26)27/h1,4-12H,2H3,(H,29,31)(H,30,32) |
| InChIKey | KCQMZBLIJSJVAN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|