C15H22O3 — CID 169491949
(2S)-1-(3-ethyl-2,4-dihydroxyphenyl)-2-methylhexan-1-one (PubChem CID 169491949) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S)-1-(3-ethyl-2,4-dihydroxyphenyl)-2-methylhexan-1-one.
| Compound Name | (2S)-1-(3-ethyl-2,4-dihydroxyphenyl)-2-methylhexan-1-one |
|---|---|
| PubChem CID | 169491949 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S)-1-(3-ethyl-2,4-dihydroxyphenyl)-2-methylhexan-1-one |
| SMILES | CCCC[C@H](C)C(=O)c1ccc(O)c(CC)c1O |
| InChI | InChI=1S/C15H22O3/c1-4-6-7-10(3)14(17)12-8-9-13(16)11(5-2)15(12)18/h8-10,16,18H,4-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | PLVKWJZWAJSIOE-JTQLQIEISA-N |
| XLogP | 3.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |