C27H36O6 — CID 169492662
3-[(7S)-15-carboxy-7-hydroxy-3,7,11-trimethylhexadeca-2,5,10,14-tetraenyl]-4-hydroxybenzoic acid (PubChem CID 169492662) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-[(7S)-15-carboxy-7-hydroxy-3,7,11-trimethylhexadeca-2,5,10,14-tetraenyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[(7S)-15-carboxy-7-hydroxy-3,7,11-trimethylhexadeca-2,5,10,14-tetraenyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 169492662 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-[(7S)-15-carboxy-7-hydroxy-3,7,11-trimethylhexadeca-2,5,10,14-tetraenyl]-4-hydroxybenzoic acid |
| SMILES | CC(=CCc1cc(C(=O)O)ccc1O)CC=C[C@@](C)(O)CCC=C(C)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C27H36O6/c1-19(8-5-11-21(3)25(29)30)9-6-16-27(4,33)17-7-10-20(2)12-13-22-18-23(26(31)32)14-15-24(22)28/h7,9,11-12,14-15,17-18,28,33H,5-6,8,10,13,16H2,1-4H3,(H,29,30)(H,31,32)/t27-/m0/s1 |
| InChIKey | LXJZBWDMDHSMJN-MHZLTWQESA-N |
| XLogP | 5.81 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|