C12H11IN6S — CID 169499406
2-(4-iodo-3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 169499406) has the molecular formula C12H11IN6S and a molecular weight of 398.23 g/mol. Its IUPAC name is 2-(4-iodo-3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(4-iodo-3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 169499406 |
| Molecular Formula | C12H11IN6S |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2-(4-iodo-3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | CSc1nc(N)n2nc(-c3ccc(I)c(C)c3)nc2n1 |
| InChI | InChI=1S/C12H11IN6S/c1-6-5-7(3-4-8(6)13)9-15-11-17-12(20-2)16-10(14)19(11)18-9/h3-5H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | UAQUWJFGYHGCSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|