C20H21FN6O5S — CID 16959220
2-(7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 16959220) has the molecular formula C20H21FN6O5S and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-(7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-(7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16959220 |
| Molecular Formula | C20H21FN6O5S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-(7-tert-butyl-1,3-dimethyl-2,4-dioxopyrimido[4,5-d]pyrimidin-5-yl)sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | Cn1c(=O)c2c(SCC(=O)Nc3ccc(F)c([N+](=O)[O-])c3)nc(C(C)(C)C)nc2n(C)c1=O |
| InChI | InChI=1S/C20H21FN6O5S/c1-20(2,3)18-23-15-14(17(29)26(5)19(30)25(15)4)16(24-18)33-9-13(28)22-10-6-7-11(21)12(8-10)27(31)32/h6-8H,9H2,1-5H3,(H,22,28) |
| InChIKey | YFEWUVLFANGKEA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|