C21H25N3O3S — CID 16960919
4-(3-methylpiperidin-1-yl)-3-nitro-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 16960919) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-(3-methylpiperidin-1-yl)-3-nitro-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(3-methylpiperidin-1-yl)-3-nitro-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 16960919 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-(3-methylpiperidin-1-yl)-3-nitro-N-prop-2-enyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)c1ccc(N2CCCC(C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25N3O3S/c1-3-10-23(15-18-7-5-12-28-18)21(25)17-8-9-19(20(13-17)24(26)27)22-11-4-6-16(2)14-22/h3,5,7-9,12-13,16H,1,4,6,10-11,14-15H2,2H3 |
| InChIKey | NYZOYXNCYJBQGD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|