C21H27N3O4S — CID 18121935
4-(azepan-1-yl)-N-(2-methoxyethyl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 18121935) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-(2-methoxyethyl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(azepan-1-yl)-N-(2-methoxyethyl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18121935 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-(azepan-1-yl)-N-(2-methoxyethyl)-3-nitro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COCCN(Cc1cccs1)C(=O)c1ccc(N2CCCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27N3O4S/c1-28-13-12-23(16-18-7-6-14-29-18)21(25)17-8-9-19(20(15-17)24(26)27)22-10-4-2-3-5-11-22/h6-9,14-15H,2-5,10-13,16H2,1H3 |
| InChIKey | VMOUAZKUECFPIV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|