C12H13N5O3 — CID 16962880
2-(methylamino)-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide (PubChem CID 16962880) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-(methylamino)-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide.
| Compound Name | 2-(methylamino)-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16962880 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(methylamino)-N-(1-methylpyrazol-3-yl)-5-nitrobenzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C12H13N5O3/c1-13-10-4-3-8(17(19)20)7-9(10)12(18)14-11-5-6-16(2)15-11/h3-7,13H,1-2H3,(H,14,15,18) |
| InChIKey | GMGUNNFHQTXYOV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|