C16H15N5O3S — CID 56555778
2-(methylamino)-N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-5-nitrobenzamide (PubChem CID 56555778) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-(methylamino)-N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-5-nitrobenzamide.
| Compound Name | 2-(methylamino)-N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 56555778 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(methylamino)-N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-5-nitrobenzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(-c2ccc(C)s2)[nH]n1 |
| InChI | InChI=1S/C16H15N5O3S/c1-9-3-6-14(25-9)13-8-15(20-19-13)18-16(22)11-7-10(21(23)24)4-5-12(11)17-2/h3-8,17H,1-2H3,(H2,18,19,20,22) |
| InChIKey | STXHKDVWDDTVCD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|