C24H29N3O — CID 16964563
4-(1-pentylbenzimidazol-2-yl)-1-(1-phenylethyl)pyrrolidin-2-one (PubChem CID 16964563) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-(1-pentylbenzimidazol-2-yl)-1-(1-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-(1-pentylbenzimidazol-2-yl)-1-(1-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 16964563 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-(1-pentylbenzimidazol-2-yl)-1-(1-phenylethyl)pyrrolidin-2-one |
| SMILES | CCCCCn1c(C2CC(=O)N(C(C)c3ccccc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N3O/c1-3-4-10-15-26-22-14-9-8-13-21(22)25-24(26)20-16-23(28)27(17-20)18(2)19-11-6-5-7-12-19/h5-9,11-14,18,20H,3-4,10,15-17H2,1-2H3 |
| InChIKey | RZTGXVIKMMEMCL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|