C31H35N3O2 — CID 16964661
4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one (PubChem CID 16964661) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 16964661 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 4-[1-[4-(2,6-dimethylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one |
| SMILES | Cc1cccc(C)c1OCCCCn1c(C2CC(=O)N(C(C)c3ccccc3)C2)nc2ccccc21 |
| InChI | InChI=1S/C31H35N3O2/c1-22-12-11-13-23(2)30(22)36-19-10-9-18-33-28-17-8-7-16-27(28)32-31(33)26-20-29(35)34(21-26)24(3)25-14-5-4-6-15-25/h4-8,11-17,24,26H,9-10,18-21H2,1-3H3 |
| InChIKey | DRLGZKOUZGXBKA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|