C33H39N3O2 — CID 16964663
4-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one (PubChem CID 16964663) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is 4-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 16964663 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 4-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]-1-(1-phenylethyl)pyrrolidin-2-one |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(C3CC(=O)N(C(C)c4ccccc4)C3)nc3ccccc32)c1 |
| InChI | InChI=1S/C33H39N3O2/c1-23(2)28-17-16-24(3)20-31(28)38-19-11-10-18-35-30-15-9-8-14-29(30)34-33(35)27-21-32(37)36(22-27)25(4)26-12-6-5-7-13-26/h5-9,12-17,20,23,25,27H,10-11,18-19,21-22H2,1-4H3 |
| InChIKey | AHSNBKLUUNLXLW-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|